C18H28N2O4 — CID 95341869
(2R)-1-[4-[(2R)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-2-phenoxypropan-1-one (PubChem CID 95341869) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R)-1-[4-[(2R)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-2-phenoxypropan-1-one.
| Compound Name | (2R)-1-[4-[(2R)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-2-phenoxypropan-1-one |
|---|---|
| PubChem CID | 95341869 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2R)-1-[4-[(2R)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-2-phenoxypropan-1-one |
| SMILES | CCOC[C@H](O)CN1CCN(C(=O)[C@@H](C)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O4/c1-3-23-14-16(21)13-19-9-11-20(12-10-19)18(22)15(2)24-17-7-5-4-6-8-17/h4-8,15-16,21H,3,9-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | PLGMRKWGDCSDER-HZPDHXFCSA-N |
| XLogP | 1.00 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |