C18H32N4O2 — CID 95342782
(2S)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 95342782) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | (2S)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 95342782 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | (2S)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]piperidin-1-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)[C@H](C)N1CCCC[C@@H]1Cn1nc(C)cc1C |
| InChI | InChI=1S/C18H32N4O2/c1-14-12-15(2)22(20-14)13-17-8-5-6-10-21(17)16(3)18(23)19-9-7-11-24-4/h12,16-17H,5-11,13H2,1-4H3,(H,19,23)/t16-,17+/m0/s1 |
| InChIKey | BHRVDHQXPDGTIA-DLBZAZTESA-N |
| XLogP | 1.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|