C16H27ClN4O2 — CID 129461213
(2R)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-N-(3-methoxypropyl)propanamide (PubChem CID 129461213) has the molecular formula C16H27ClN4O2 and a molecular weight of 342.87 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-N-(3-methoxypropyl)propanamide.
| Compound Name | (2R)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 129461213 |
| Molecular Formula | C16H27ClN4O2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R)-2-[(2S)-2-(5-chloro-1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)[C@@H](C)N1CCC[C@H]1c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C16H27ClN4O2/c1-11-14(15(17)20(3)19-11)13-7-5-9-21(13)12(2)16(22)18-8-6-10-23-4/h12-13H,5-10H2,1-4H3,(H,18,22)/t12-,13+/m1/s1 |
| InChIKey | PBPSWHVCQFVRPB-OLZOCXBDSA-N |
| XLogP | 2.06 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|