C20H25F3N2OS — CID 95343608
(2R)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 95343608) has the molecular formula C20H25F3N2OS and a molecular weight of 398.49 g/mol. Its IUPAC name is (2R)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | (2R)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 95343608 |
| Molecular Formula | C20H25F3N2OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2R)-1-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]-2-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | C[C@](O)(CN1CCN(CCc2cccs2)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H25F3N2OS/c1-19(26,16-4-2-5-17(14-16)20(21,22)23)15-25-11-9-24(10-12-25)8-7-18-6-3-13-27-18/h2-6,13-14,26H,7-12,15H2,1H3/t19-/m0/s1 |
| InChIKey | AZZJZOFZQUTBBZ-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |