C17H25N3O3 — CID 95343819
(2S)-1-(furan-2-ylmethoxy)-3-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol (PubChem CID 95343819) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is (2S)-1-(furan-2-ylmethoxy)-3-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(furan-2-ylmethoxy)-3-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 95343819 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2S)-1-(furan-2-ylmethoxy)-3-[(2R)-2-(pyrazol-1-ylmethyl)piperidin-1-yl]propan-2-ol |
| SMILES | O[C@H](COCc1ccco1)CN1CCCC[C@@H]1Cn1cccn1 |
| InChI | InChI=1S/C17H25N3O3/c21-16(13-22-14-17-6-3-10-23-17)12-19-8-2-1-5-15(19)11-20-9-4-7-18-20/h3-4,6-7,9-10,15-16,21H,1-2,5,8,11-14H2/t15-,16+/m1/s1 |
| InChIKey | WANJWSZATCRSPQ-CVEARBPZSA-N |
| XLogP | 1.91 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |