C17H19F2NO4S — CID 95346191
N-[(1R)-6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetamide (PubChem CID 95346191) has the molecular formula C17H19F2NO4S and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[(1R)-6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetamide.
| Compound Name | N-[(1R)-6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 95346191 |
| Molecular Formula | C17H19F2NO4S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[(1R)-6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1C=CS(=O)(=O)C1)N[C@@H]1CCCc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C17H19F2NO4S/c18-17(19)24-13-4-5-14-12(9-13)2-1-3-15(14)20-16(21)8-11-6-7-25(22,23)10-11/h4-7,9,11,15,17H,1-3,8,10H2,(H,20,21)/t11-,15+/m0/s1 |
| InChIKey | UEGCOXLUWOYLNP-XHDPSFHLSA-N |
| XLogP | 2.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |