C18H26N2O4 — CID 95347120
N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-N'-(4-ethoxyphenyl)oxamide (PubChem CID 95347120) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-N'-(4-ethoxyphenyl)oxamide.
| Compound Name | N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-N'-(4-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 95347120 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[(2S)-2-cyclohexyl-2-hydroxyethyl]-N'-(4-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NC[C@@H](O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-2-24-15-10-8-14(9-11-15)20-18(23)17(22)19-12-16(21)13-6-4-3-5-7-13/h8-11,13,16,21H,2-7,12H2,1H3,(H,19,22)(H,20,23)/t16-/m1/s1 |
| InChIKey | BHFXOQNTWFENRG-MRXNPFEDSA-N |
| XLogP | 2.08 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|