C18H24N4OS — CID 95347682
1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]ethanone (PubChem CID 95347682) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]ethanone.
| Compound Name | 1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]ethanone |
|---|---|
| PubChem CID | 95347682 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-2-[2-(4-methylpyrazol-1-yl)ethylamino]ethanone |
| SMILES | Cc1cnn(CCNCC(=O)N2CC[C@@H](C)Sc3ccccc32)c1 |
| InChI | InChI=1S/C18H24N4OS/c1-14-11-20-21(13-14)10-8-19-12-18(23)22-9-7-15(2)24-17-6-4-3-5-16(17)22/h3-6,11,13,15,19H,7-10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | CYVPGALISZHDMZ-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|