C17H19N3OS — CID 51644135
(E)-1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-3-(1-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 51644135) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (E)-1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-3-(1-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-3-(1-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51644135 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (E)-1-[(2R)-2-methyl-3,4-dihydro-2H-1,5-benzothiazepin-5-yl]-3-(1-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | C[C@@H]1CCN(C(=O)/C=C/c2cnn(C)c2)c2ccccc2S1 |
| InChI | InChI=1S/C17H19N3OS/c1-13-9-10-20(15-5-3-4-6-16(15)22-13)17(21)8-7-14-11-18-19(2)12-14/h3-8,11-13H,9-10H2,1-2H3/b8-7+/t13-/m1/s1 |
| InChIKey | BMGZSTHTGOZGAB-SBDDDAINSA-N |
| XLogP | 3.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|