C15H22N2O2S — CID 95347748
1-cyclohexyl-3-[2-[(R)-phenylsulfinyl]ethyl]urea (PubChem CID 95347748) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[(R)-phenylsulfinyl]ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-[(R)-phenylsulfinyl]ethyl]urea |
|---|---|
| PubChem CID | 95347748 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-cyclohexyl-3-[2-[(R)-phenylsulfinyl]ethyl]urea |
| SMILES | O=C(NCC[S@@](=O)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C15H22N2O2S/c18-15(17-13-7-3-1-4-8-13)16-11-12-20(19)14-9-5-2-6-10-14/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2,(H2,16,17,18)/t20-/m1/s1 |
| InChIKey | MDDMQCMRJFGPBE-HXUWFJFHSA-N |
| XLogP | 2.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |