C15H18F3N3O — CID 95348037
(1R)-2-[2-(4-methylpyrazol-1-yl)ethylamino]-1-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 95348037) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is (1R)-2-[2-(4-methylpyrazol-1-yl)ethylamino]-1-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | (1R)-2-[2-(4-methylpyrazol-1-yl)ethylamino]-1-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 95348037 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (1R)-2-[2-(4-methylpyrazol-1-yl)ethylamino]-1-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1cnn(CCNC[C@H](O)c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H18F3N3O/c1-11-8-20-21(10-11)7-6-19-9-14(22)12-2-4-13(5-3-12)15(16,17)18/h2-5,8,10,14,19,22H,6-7,9H2,1H3/t14-/m0/s1 |
| InChIKey | ROJQNFFMXBPQLQ-AWEZNQCLSA-N |
| XLogP | 2.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|