C15H20FN3O2 — CID 95750367
(2R)-1-(4-fluorophenoxy)-3-[2-(4-methylpyrazol-1-yl)ethylamino]propan-2-ol (PubChem CID 95750367) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is (2R)-1-(4-fluorophenoxy)-3-[2-(4-methylpyrazol-1-yl)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-(4-fluorophenoxy)-3-[2-(4-methylpyrazol-1-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 95750367 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R)-1-(4-fluorophenoxy)-3-[2-(4-methylpyrazol-1-yl)ethylamino]propan-2-ol |
| SMILES | Cc1cnn(CCNC[C@@H](O)COc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H20FN3O2/c1-12-8-18-19(10-12)7-6-17-9-14(20)11-21-15-4-2-13(16)3-5-15/h2-5,8,10,14,17,20H,6-7,9,11H2,1H3/t14-/m1/s1 |
| InChIKey | ZOZQJIZXTMVYJD-CQSZACIVSA-N |
| XLogP | 1.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|