C16H27N5O2 — CID 95349254
N-(2-acetamidoethyl)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]acetamide (PubChem CID 95349254) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95349254 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(2R)-2-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidin-1-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)CN1CCC[C@@H]1Cn1nc(C)cc1C |
| InChI | InChI=1S/C16H27N5O2/c1-12-9-13(2)21(19-12)10-15-5-4-8-20(15)11-16(23)18-7-6-17-14(3)22/h9,15H,4-8,10-11H2,1-3H3,(H,17,22)(H,18,23)/t15-/m1/s1 |
| InChIKey | UDTNPPAKJLWTIG-OAHLLOKOSA-N |
| XLogP | 0.22 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|