C26H27N3O4 — CID 95350767
(4aS,8aS)-3-[3-[(2S)-2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione (PubChem CID 95350767) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (4aS,8aS)-3-[3-[(2S)-2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione.
| Compound Name | (4aS,8aS)-3-[3-[(2S)-2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 95350767 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (4aS,8aS)-3-[3-[(2S)-2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]phenyl]-4a,5,8,8a-tetrahydro-2H-phthalazine-1,4-dione |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)c2cccc(N3NC(=O)[C@H]4CC=CC[C@@H]4C3=O)c2)cc1 |
| InChI | InChI=1S/C26H27N3O4/c1-33-20-13-11-17(12-14-20)23-10-5-15-28(23)25(31)18-6-4-7-19(16-18)29-26(32)22-9-3-2-8-21(22)24(30)27-29/h2-4,6-7,11-14,16,21-23H,5,8-10,15H2,1H3,(H,27,30)/t21-,22-,23-/m0/s1 |
| InChIKey | JBQKNBOPOYOXCD-VABKMULXSA-N |
| XLogP | 3.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|