C21H21N3O3S — CID 51264700
7-[2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 51264700) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 7-[2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 51264700 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 7-[2-(4-methoxyphenyl)pyrrolidine-1-carbonyl]-3-methyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COc1ccc(C2CCCN2C(=O)c2ccc3c(=O)n(C)c(=S)[nH]c3c2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-23-20(26)16-10-7-14(12-17(16)22-21(23)28)19(25)24-11-3-4-18(24)13-5-8-15(27-2)9-6-13/h5-10,12,18H,3-4,11H2,1-2H3,(H,22,28) |
| InChIKey | MOUXWYOLDPRAPG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|