C19H16FN3O2S — CID 95045601
7-[(2S)-2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 95045601) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 7-[(2S)-2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[(2S)-2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 95045601 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 7-[(2S)-2-(4-fluorophenyl)pyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(c1ccc2c(=O)[nH]c(=S)[nH]c2c1)N1CCC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FN3O2S/c20-13-6-3-11(4-7-13)16-2-1-9-23(16)18(25)12-5-8-14-15(10-12)21-19(26)22-17(14)24/h3-8,10,16H,1-2,9H2,(H2,21,22,24,26)/t16-/m0/s1 |
| InChIKey | MLSADISHLXPMPC-INIZCTEOSA-N |
| XLogP | 3.70 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|