C17H19N3O2S2 — CID 99814874
7-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine-4-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 99814874) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 7-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine-4-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine-4-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 99814874 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 7-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine-4-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(c1ccc2c(=O)[nH]c(=S)[nH]c2c1)N1CCS[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C17H19N3O2S2/c21-15-11-6-5-10(9-12(11)18-17(23)19-15)16(22)20-7-8-24-14-4-2-1-3-13(14)20/h5-6,9,13-14H,1-4,7-8H2,(H2,18,19,21,23)/t13-,14-/m1/s1 |
| InChIKey | PMTQRYJXNAMOOZ-ZIAGYGMSSA-N |
| XLogP | 3.09 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|