C17H15N3O2S2 — CID 95045596
2-sulfanylidene-7-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]-1H-quinazolin-4-one (PubChem CID 95045596) has the molecular formula C17H15N3O2S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-sulfanylidene-7-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]-1H-quinazolin-4-one.
| Compound Name | 2-sulfanylidene-7-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 95045596 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-sulfanylidene-7-[(2R)-2-thiophen-2-ylpyrrolidine-1-carbonyl]-1H-quinazolin-4-one |
| SMILES | O=C(c1ccc2c(=O)[nH]c(=S)[nH]c2c1)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C17H15N3O2S2/c21-15-11-6-5-10(9-12(11)18-17(23)19-15)16(22)20-7-1-3-13(20)14-4-2-8-24-14/h2,4-6,8-9,13H,1,3,7H2,(H2,18,19,21,23)/t13-/m1/s1 |
| InChIKey | BQJGZGSWAFFAMP-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|