C15H18N2O4S — CID 122138826
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxy-3-nitrophenyl)methanone (PubChem CID 122138826) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxy-3-nitrophenyl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxy-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 122138826 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxy-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(O)c([N+](=O)[O-])c1)N1CCSC2CCCCC21 |
| InChI | InChI=1S/C15H18N2O4S/c18-13-6-5-10(9-12(13)17(20)21)15(19)16-7-8-22-14-4-2-1-3-11(14)16/h5-6,9,11,14,18H,1-4,7-8H2 |
| InChIKey | OSOYSUSQTRFCFK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|