C25H27N3O5S — CID 46548249
7-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 46548249) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 7-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 46548249 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 7-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)N3CCCC3c3ccc4c(c3)OCCO4)ccc2c1=O |
| InChI | InChI=1S/C25H27N3O5S/c1-31-11-3-10-28-24(30)18-7-5-17(14-19(18)26-25(28)34)23(29)27-9-2-4-20(27)16-6-8-21-22(15-16)33-13-12-32-21/h5-8,14-15,20H,2-4,9-13H2,1H3,(H,26,34) |
| InChIKey | NGWHMSRMWKOXOS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|