C27H27N3O3S — CID 98283303
3-(3-methoxypropyl)-7-[(2S)-2-naphthalen-1-ylpyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 98283303) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-7-[(2S)-2-naphthalen-1-ylpyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(3-methoxypropyl)-7-[(2S)-2-naphthalen-1-ylpyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 98283303 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 3-(3-methoxypropyl)-7-[(2S)-2-naphthalen-1-ylpyrrolidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)N3CCC[C@H]3c3cccc4ccccc34)ccc2c1=O |
| InChI | InChI=1S/C27H27N3O3S/c1-33-16-6-15-30-26(32)22-13-12-19(17-23(22)28-27(30)34)25(31)29-14-5-11-24(29)21-10-4-8-18-7-2-3-9-20(18)21/h2-4,7-10,12-13,17,24H,5-6,11,14-16H2,1H3,(H,28,34)/t24-/m0/s1 |
| InChIKey | BBQSFBVJYSVZAK-DEOSSOPVSA-N |
| XLogP | 5.23 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|