C24H24N4O3 — CID 126951131
2-[1-(1H-indole-6-carbonyl)pyrrolidin-2-yl]-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 126951131) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[1-(1H-indole-6-carbonyl)pyrrolidin-2-yl]-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 2-[1-(1H-indole-6-carbonyl)pyrrolidin-2-yl]-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126951131 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[1-(1H-indole-6-carbonyl)pyrrolidin-2-yl]-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1c(C2CCCN2C(=O)c2ccc3cc[nH]c3c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H24N4O3/c1-31-14-13-28-22(26-19-6-3-2-5-18(19)24(28)30)21-7-4-12-27(21)23(29)17-9-8-16-10-11-25-20(16)15-17/h2-3,5-6,8-11,15,21,25H,4,7,12-14H2,1H3 |
| InChIKey | FHTVASIGXAKOTG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |