C19H19N5O — CID 95354686
2-[2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]indol-1-yl]acetonitrile (PubChem CID 95354686) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]indol-1-yl]acetonitrile.
| Compound Name | 2-[2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 95354686 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]indol-1-yl]acetonitrile |
| SMILES | N#CCn1c(C(=O)N2CCC[C@@H]2Cn2cccn2)cc2ccccc21 |
| InChI | InChI=1S/C19H19N5O/c20-8-12-24-17-7-2-1-5-15(17)13-18(24)19(25)23-11-3-6-16(23)14-22-10-4-9-21-22/h1-2,4-5,7,9-10,13,16H,3,6,11-12,14H2/t16-/m1/s1 |
| InChIKey | BDBBNFPCJUERFZ-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 66.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |