C13H17ClN2O2 — CID 95362363
3-amino-5-chloro-4-[(2R)-2-methylpiperidin-1-yl]benzoic acid (PubChem CID 95362363) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 3-amino-5-chloro-4-[(2R)-2-methylpiperidin-1-yl]benzoic acid.
| Compound Name | 3-amino-5-chloro-4-[(2R)-2-methylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 95362363 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-amino-5-chloro-4-[(2R)-2-methylpiperidin-1-yl]benzoic acid |
| SMILES | C[C@@H]1CCCCN1c1c(N)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O2/c1-8-4-2-3-5-16(8)12-10(14)6-9(13(17)18)7-11(12)15/h6-8H,2-5,15H2,1H3,(H,17,18)/t8-/m1/s1 |
| InChIKey | ZHDOAZHIEYFETA-MRVPVSSYSA-N |
| XLogP | 3.00 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|