C10H17N3 — CID 95367642
cis-(1R,3S)-3-(1-methylimidazol-2-yl)cyclohexan-1-amine (PubChem CID 95367642) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is cis-(1R,3S)-3-(1-methylimidazol-2-yl)cyclohexan-1-amine.
| Compound Name | cis-(1R,3S)-3-(1-methylimidazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 95367642 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | cis-(1R,3S)-3-(1-methylimidazol-2-yl)cyclohexan-1-amine |
| SMILES | Cn1ccnc1[C@H]1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C10H17N3/c1-13-6-5-12-10(13)8-3-2-4-9(11)7-8/h5-6,8-9H,2-4,7,11H2,1H3/t8-,9+/m0/s1 |
| InChIKey | SQABZNUSMMDNOR-DTWKUNHWSA-N |
| XLogP | 1.40 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |