C15H14F2N2O3S — CID 95369155
1-(3,4-difluorobenzoyl)-N-[(3R)-2-oxothiolan-3-yl]azetidine-3-carboxamide (PubChem CID 95369155) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-(3,4-difluorobenzoyl)-N-[(3R)-2-oxothiolan-3-yl]azetidine-3-carboxamide.
| Compound Name | 1-(3,4-difluorobenzoyl)-N-[(3R)-2-oxothiolan-3-yl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 95369155 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-(3,4-difluorobenzoyl)-N-[(3R)-2-oxothiolan-3-yl]azetidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCSC1=O)C1CN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H14F2N2O3S/c16-10-2-1-8(5-11(10)17)14(21)19-6-9(7-19)13(20)18-12-3-4-23-15(12)22/h1-2,5,9,12H,3-4,6-7H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | GPYVHFFIFIOTJV-GFCCVEGCSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|