C33H33N5O4 — CID 95373671
4-[(10R,15S)-10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 95373671) has the molecular formula C33H33N5O4 and a molecular weight of 563.66 g/mol. Its IUPAC name is 4-[(10R,15S)-10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[(10R,15S)-10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 95373671 |
| Molecular Formula | C33H33N5O4 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 4-[(10R,15S)-10-(4-methylphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Cc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H]3C(=O)N(c4ccc(C(=O)NCCN5CCOCC5)cc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C33H33N5O4/c1-21-6-8-22(9-7-21)30-29-26(25-4-2-3-5-27(25)35-29)20-28-32(40)37(33(41)38(28)30)24-12-10-23(11-13-24)31(39)34-14-15-36-16-18-42-19-17-36/h2-13,28,30,35H,14-20H2,1H3,(H,34,39)/t28-,30+/m0/s1 |
| InChIKey | CZZADGMHIWBXEN-MFMCTBQISA-N |
| XLogP | 4.02 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|