C29H37N3O5S — CID 95374240
(3R,9bS)-N-[(2S,3S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 95374240) has the molecular formula C29H37N3O5S and a molecular weight of 539.70 g/mol. Its IUPAC name is (3R,9bS)-N-[(2S,3S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[(2S,3S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 95374240 |
| Molecular Formula | C29H37N3O5S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (3R,9bS)-N-[(2S,3S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-methyl-1-oxopentan-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@@H]2SC1(C)C)C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H37N3O5S/c1-7-17(2)23(25(33)30-15-14-18-12-13-21(36-5)22(16-18)37-6)31-26(34)24-29(3,4)38-28-20-11-9-8-10-19(20)27(35)32(24)28/h8-13,16-17,23-24,28H,7,14-15H2,1-6H3,(H,30,33)(H,31,34)/t17-,23-,24+,28-/m0/s1 |
| InChIKey | AROXQSYUOSPXAV-IEYXVUCYSA-N |
| XLogP | 3.94 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |