C23H26N2O4S — CID 3721389
N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 3721389) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 3721389 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2N3C(=O)c4ccccc4C3SC2(C)C)cc1OC |
| InChI | InChI=1S/C23H26N2O4S/c1-23(2)19(25-21(27)15-7-5-6-8-16(15)22(25)30-23)20(26)24-12-11-14-9-10-17(28-3)18(13-14)29-4/h5-10,13,19,22H,11-12H2,1-4H3,(H,24,26) |
| InChIKey | WHXQDEDJMXDVBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |