C17H18N4O3S2 — CID 124879966
(3R,9bS)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 124879966) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (3R,9bS)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bS)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 124879966 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3R,9bS)-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | COCc1nnc(NC(=O)[C@H]2N3C(=O)c4ccccc4[C@@H]3SC2(C)C)s1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-17(2)12(13(22)18-16-20-19-11(25-16)8-24-3)21-14(23)9-6-4-5-7-10(9)15(21)26-17/h4-7,12,15H,8H2,1-3H3,(H,18,20,22)/t12-,15+/m1/s1 |
| InChIKey | XWPFPLCLEDAUJE-DOMZBBRYSA-N |
| XLogP | 2.67 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |