C22H26N4O3S2 — CID 41057979
(3R,9bR)-2,2-dimethyl-N-[(2S)-4-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide (PubChem CID 41057979) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (3R,9bR)-2,2-dimethyl-N-[(2S)-4-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide.
| Compound Name | (3R,9bR)-2,2-dimethyl-N-[(2S)-4-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
|---|---|
| PubChem CID | 41057979 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (3R,9bR)-2,2-dimethyl-N-[(2S)-4-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)pentan-2-yl]-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@H]2SC1(C)C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-12(2)11-15(17(27)25-21-23-9-10-30-21)24-18(28)16-22(3,4)31-20-14-8-6-5-7-13(14)19(29)26(16)20/h5-10,12,15-16,20H,11H2,1-4H3,(H,24,28)(H,23,25,27)/t15-,16+,20+/m0/s1 |
| InChIKey | MMDBQLGRUVQQNH-RZQQEMMASA-N |
| XLogP | 3.66 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |