C19H23N2O4S- — CID 7095351
(2S)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-4-methylpentanoate (PubChem CID 7095351) has the molecular formula C19H23N2O4S- and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7095351 |
| Molecular Formula | C19H23N2O4S- |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2S)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@H]2SC1(C)C)C(=O)[O-] |
| InChI | InChI=1S/C19H24N2O4S/c1-10(2)9-13(18(24)25)20-15(22)14-19(3,4)26-17-12-8-6-5-7-11(12)16(23)21(14)17/h5-8,10,13-14,17H,9H2,1-4H3,(H,20,22)(H,24,25)/p-1/t13-,14+,17+/m0/s1 |
| InChIKey | GFQDWFQULTXWLV-JJRVBVJISA-M |
| XLogP | 1.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |