C17H19N2O5S- — CID 7094861
(2R,3R)-2-[[(3R,9bS)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-hydroxybutanoate (PubChem CID 7094861) has the molecular formula C17H19N2O5S- and a molecular weight of 363.42 g/mol. Its IUPAC name is (2R,3R)-2-[[(3R,9bS)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-hydroxybutanoate.
| Compound Name | (2R,3R)-2-[[(3R,9bS)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 7094861 |
| Molecular Formula | C17H19N2O5S- |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2R,3R)-2-[[(3R,9bS)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@@H](NC(=O)[C@H]1N2C(=O)c3ccccc3[C@@H]2SC1(C)C)C(=O)[O-] |
| InChI | InChI=1S/C17H20N2O5S/c1-8(20)11(16(23)24)18-13(21)12-17(2,3)25-15-10-7-5-4-6-9(10)14(22)19(12)15/h4-8,11-12,15,20H,1-3H3,(H,18,21)(H,23,24)/p-1/t8-,11-,12-,15+/m1/s1 |
| InChIKey | LZBURFZSWMUWSF-NBZZCRHSSA-M |
| XLogP | -0.35 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |