C16H17N2O4S2- — CID 7068712
(2R)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 7068712) has the molecular formula C16H17N2O4S2- and a molecular weight of 365.46 g/mol. Its IUPAC name is (2R)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | (2R)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 7068712 |
| Molecular Formula | C16H17N2O4S2- |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (2R)-2-[[(3R,9bR)-2,2-dimethyl-5-oxo-3,9b-dihydro-[1,3]thiazolo[2,3-a]isoindole-3-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | CC1(C)S[C@@H]2c3ccccc3C(=O)N2[C@@H]1C(=O)N[C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C16H18N2O4S2/c1-16(2)11(12(19)17-10(7-23)15(21)22)18-13(20)8-5-3-4-6-9(8)14(18)24-16/h3-6,10-11,14,23H,7H2,1-2H3,(H,17,19)(H,21,22)/p-1/t10-,11+,14+/m0/s1 |
| InChIKey | AXPVWECFESKBBZ-MISXGVKJSA-M |
| XLogP | 0.20 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|