C16H24N4O3 — CID 95376646
tert-butyl (2S)-2-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylate (PubChem CID 95376646) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95376646 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tert-butyl (2S)-2-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1CNC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H24N4O3/c1-16(2,3)23-15(22)20-9-5-4-6-12(20)10-19-14(21)13-11-17-7-8-18-13/h7-8,11-12H,4-6,9-10H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | TVGRFVFLZROAJN-LBPRGKRZSA-N |
| XLogP | 2.00 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |