C11H17BrN2 — CID 95376898
3-[(4R)-4-bromohexyl]pyridin-2-amine (PubChem CID 95376898) has the molecular formula C11H17BrN2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 3-[(4R)-4-bromohexyl]pyridin-2-amine.
| Compound Name | 3-[(4R)-4-bromohexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 95376898 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-[(4R)-4-bromohexyl]pyridin-2-amine |
| SMILES | CC[C@@H](Br)CCCc1cccnc1N |
| InChI | InChI=1S/C11H17BrN2/c1-2-10(12)7-3-5-9-6-4-8-14-11(9)13/h4,6,8,10H,2-3,5,7H2,1H3,(H2,13,14)/t10-/m1/s1 |
| InChIKey | GLUHZTWFESUJGA-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|