About ethane;3-propylpyridin-2-amine
ethane;3-propylpyridin-2-amine (PubChem CID 176926436) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;3-propylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;3-propylpyridin-2-amine |
| PubChem CID | 176926436 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | ethane;3-propylpyridin-2-amine |
| SMILES | CC.CCCc1cccnc1N |
| InChI | InChI=1S/C8H12N2.C2H6/c1-2-4-7-5-3-6-10-8(7)9;1-2/h3,5-6H,2,4H2,1H3,(H2,9,10);1-2H3 |
| InChIKey | YIWNZHRNESRSGM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-propylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-propylpyridin-2-amine?
The IUPAC name of ethane;3-propylpyridin-2-amine (CID 176926436) is ethane;3-propylpyridin-2-amine.
What is the SMILES notation for ethane;3-propylpyridin-2-amine?
The canonical SMILES for ethane;3-propylpyridin-2-amine is CC.CCCc1cccnc1N.
What is the InChIKey of ethane;3-propylpyridin-2-amine?
The InChIKey is YIWNZHRNESRSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c1-2-4-7-5-3-6-10-8(7)9;1-2/h3,5-6H,2,4H2,1H3,(H2,9,10);1-2H3.
What are the key properties of ethane;3-propylpyridin-2-amine?
ethane;3-propylpyridin-2-amine has a molecular weight of 166.27 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-propylpyridin-2-amine is sourced from PubChem (CID 176926436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).