About 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane
3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane (PubChem CID 162183420) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane.
Molecular Properties
| Compound Name | 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane |
| PubChem CID | 162183420 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane |
| SMILES | CC.CC(C)(C)C.NCc1cccnc1N |
| InChI | InChI=1S/C6H9N3.C5H12.C2H6/c7-4-5-2-1-3-9-6(5)8;1-5(2,3)4;1-2/h1-3H,4,7H2,(H2,8,9);1-4H3;1-2H3 |
| InChIKey | ZPIPTRDDCSGVOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane?
The IUPAC name of 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane (CID 162183420) is 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane.
What is the SMILES notation for 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane?
The canonical SMILES for 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane is CC.CC(C)(C)C.NCc1cccnc1N.
What is the InChIKey of 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane?
The InChIKey is ZPIPTRDDCSGVOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3.C5H12.C2H6/c7-4-5-2-1-3-9-6(5)8;1-5(2,3)4;1-2/h1-3H,4,7H2,(H2,8,9);1-4H3;1-2H3.
What are the key properties of 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane?
3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane has a molecular weight of 225.38 g/mol, XLogP of 3.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane is sourced from PubChem (CID 162183420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).