C13H27N3 — CID 162183420
3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane (PubChem CID 162183420) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane.
| Compound Name | 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane |
|---|---|
| PubChem CID | 162183420 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 3-(aminomethyl)pyridin-2-amine;2,2-dimethylpropane;ethane |
| SMILES | CC.CC(C)(C)C.NCc1cccnc1N |
| InChI | InChI=1S/C6H9N3.C5H12.C2H6/c7-4-5-2-1-3-9-6(5)8;1-5(2,3)4;1-2/h1-3H,4,7H2,(H2,8,9);1-4H3;1-2H3 |
| InChIKey | ZPIPTRDDCSGVOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |