C8H13N3O — CID 95380525
2-[(2R)-2-aminobutan-2-yl]-1H-pyrimidin-6-one (PubChem CID 95380525) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(2R)-2-aminobutan-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(2R)-2-aminobutan-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 95380525 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-[(2R)-2-aminobutan-2-yl]-1H-pyrimidin-6-one |
| SMILES | CC[C@@](C)(N)c1nccc(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-3-8(2,9)7-10-5-4-6(12)11-7/h4-5H,3,9H2,1-2H3,(H,10,11,12)/t8-/m1/s1 |
| InChIKey | VVGONDJGKXRPKB-MRVPVSSYSA-N |
| XLogP | 0.35 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |