C16H19N5O2S — CID 95383272
N-(3-cyanothiophen-2-yl)-2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide (PubChem CID 95383272) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 95383272 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[(2S)-2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]acetamide |
| SMILES | Cc1cnn(C[C@@H]2CN(CC(=O)Nc3sccc3C#N)CCO2)c1 |
| InChI | InChI=1S/C16H19N5O2S/c1-12-7-18-21(8-12)10-14-9-20(3-4-23-14)11-15(22)19-16-13(6-17)2-5-24-16/h2,5,7-8,14H,3-4,9-11H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | YWKLRUDBFWRURN-AWEZNQCLSA-N |
| XLogP | 1.46 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |