C16H22ClN3O2 — CID 95383338
(2S)-2-(carbamoylamino)-N-[1-(4-chlorophenyl)cyclohexyl]propanamide (PubChem CID 95383338) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-[1-(4-chlorophenyl)cyclohexyl]propanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-[1-(4-chlorophenyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 95383338 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-[1-(4-chlorophenyl)cyclohexyl]propanamide |
| SMILES | C[C@H](NC(N)=O)C(=O)NC1(c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C16H22ClN3O2/c1-11(19-15(18)22)14(21)20-16(9-3-2-4-10-16)12-5-7-13(17)8-6-12/h5-8,11H,2-4,9-10H2,1H3,(H,20,21)(H3,18,19,22)/t11-/m0/s1 |
| InChIKey | KHBWWOJTCCSAJE-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |