C18H28ClN3 — CID 145074797
(1E,3Z)-1-N'-[1-(4-chlorophenyl)cyclopropyl]-2,3-dimethylpenta-1,3-diene-1,1,4-triamine;ethane (PubChem CID 145074797) has the molecular formula C18H28ClN3 and a molecular weight of 321.90 g/mol. Its IUPAC name is (1E,3Z)-1-N'-[1-(4-chlorophenyl)cyclopropyl]-2,3-dimethylpenta-1,3-diene-1,1,4-triamine;ethane.
| Compound Name | (1E,3Z)-1-N'-[1-(4-chlorophenyl)cyclopropyl]-2,3-dimethylpenta-1,3-diene-1,1,4-triamine;ethane |
|---|---|
| PubChem CID | 145074797 |
| Molecular Formula | C18H28ClN3 |
| Molecular Weight | 321.90 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | (1E,3Z)-1-N'-[1-(4-chlorophenyl)cyclopropyl]-2,3-dimethylpenta-1,3-diene-1,1,4-triamine;ethane |
| SMILES | C/C(N)=C(C)/C(C)=C(\N)NC1(c2ccc(Cl)cc2)CC1.CC |
| InChI | InChI=1S/C16H22ClN3.C2H6/c1-10(12(3)18)11(2)15(19)20-16(8-9-16)13-4-6-14(17)7-5-13;1-2/h4-7,20H,8-9,18-19H2,1-3H3;1-2H3/b12-10-,15-11+; |
| InChIKey | AQBKNPMVTPYMGW-IPBOBBAPSA-N |
| XLogP | 4.39 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.90 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|