C15H14F3N3OS — CID 95392263
(4S)-6-methyl-1-propan-2-yl-4-(2,3,4-trifluorophenyl)-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one (PubChem CID 95392263) has the molecular formula C15H14F3N3OS and a molecular weight of 341.36 g/mol. Its IUPAC name is (4S)-6-methyl-1-propan-2-yl-4-(2,3,4-trifluorophenyl)-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one.
| Compound Name | (4S)-6-methyl-1-propan-2-yl-4-(2,3,4-trifluorophenyl)-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 95392263 |
| Molecular Formula | C15H14F3N3OS |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (4S)-6-methyl-1-propan-2-yl-4-(2,3,4-trifluorophenyl)-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
| SMILES | CC1=Nc2c(c(=O)[nH]n2C(C)C)[C@@H](c2ccc(F)c(F)c2F)S1 |
| InChI | InChI=1S/C15H14F3N3OS/c1-6(2)21-14-10(15(22)20-21)13(23-7(3)19-14)8-4-5-9(16)12(18)11(8)17/h4-6,13H,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | HUVRICCYRQHCNM-CYBMUJFWSA-N |
| XLogP | 4.06 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|