C19H21Cl2N3O2S — CID 97426438
(4R)-4-(2,4-dichlorophenyl)-1-[(4R)-2,2-dimethyloxan-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one (PubChem CID 97426438) has the molecular formula C19H21Cl2N3O2S and a molecular weight of 426.37 g/mol. Its IUPAC name is (4R)-4-(2,4-dichlorophenyl)-1-[(4R)-2,2-dimethyloxan-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one.
| Compound Name | (4R)-4-(2,4-dichlorophenyl)-1-[(4R)-2,2-dimethyloxan-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 97426438 |
| Molecular Formula | C19H21Cl2N3O2S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (4R)-4-(2,4-dichlorophenyl)-1-[(4R)-2,2-dimethyloxan-4-yl]-6-methyl-2,4-dihydropyrazolo[3,4-d][1,3]thiazin-3-one |
| SMILES | CC1=Nc2c(c(=O)[nH]n2[C@@H]2CCOC(C)(C)C2)[C@H](c2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C19H21Cl2N3O2S/c1-10-22-17-15(16(27-10)13-5-4-11(20)8-14(13)21)18(25)23-24(17)12-6-7-26-19(2,3)9-12/h4-5,8,12,16H,6-7,9H2,1-3H3,(H,23,25)/t12-,16+/m1/s1 |
| InChIKey | PQAJZABVZXRVIX-WBMJQRKESA-N |
| XLogP | 5.50 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |