C18H20N2O3S — CID 95397039
(7R)-N-butyl-2,5-dioxo-7-thiophen-2-yl-1,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 95397039) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (7R)-N-butyl-2,5-dioxo-7-thiophen-2-yl-1,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | (7R)-N-butyl-2,5-dioxo-7-thiophen-2-yl-1,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 95397039 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (7R)-N-butyl-2,5-dioxo-7-thiophen-2-yl-1,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCCCNC(=O)c1cc2c([nH]c1=O)C[C@@H](c1cccs1)CC2=O |
| InChI | InChI=1S/C18H20N2O3S/c1-2-3-6-19-17(22)13-10-12-14(20-18(13)23)8-11(9-15(12)21)16-5-4-7-24-16/h4-5,7,10-11H,2-3,6,8-9H2,1H3,(H,19,22)(H,20,23)/t11-/m1/s1 |
| InChIKey | GRJWEMLMMPLFKQ-LLVKDONJSA-N |
| XLogP | 2.88 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|