C16H20N4S — CID 95399118
2-ethyl-5-methyl-4-[1-[(2R)-1-thiophen-3-ylpropan-2-yl]imidazol-2-yl]-1H-imidazole (PubChem CID 95399118) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-ethyl-5-methyl-4-[1-[(2R)-1-thiophen-3-ylpropan-2-yl]imidazol-2-yl]-1H-imidazole.
| Compound Name | 2-ethyl-5-methyl-4-[1-[(2R)-1-thiophen-3-ylpropan-2-yl]imidazol-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 95399118 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-ethyl-5-methyl-4-[1-[(2R)-1-thiophen-3-ylpropan-2-yl]imidazol-2-yl]-1H-imidazole |
| SMILES | CCc1nc(-c2nccn2[C@H](C)Cc2ccsc2)c(C)[nH]1 |
| InChI | InChI=1S/C16H20N4S/c1-4-14-18-12(3)15(19-14)16-17-6-7-20(16)11(2)9-13-5-8-21-10-13/h5-8,10-11H,4,9H2,1-3H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | GXMAFZJXXLMBCR-LLVKDONJSA-N |
| XLogP | 4.01 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |