C21H26N2O2 — CID 95402837
(3R)-3-(3-phenylpropyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxylic acid (PubChem CID 95402837) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3R)-3-(3-phenylpropyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-3-(3-phenylpropyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95402837 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3R)-3-(3-phenylpropyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@]1(CCCc2ccccc2)CCCN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C21H26N2O2/c24-20(25)21(11-4-8-18-6-2-1-3-7-18)12-5-15-23(17-21)16-19-9-13-22-14-10-19/h1-3,6-7,9-10,13-14H,4-5,8,11-12,15-17H2,(H,24,25)/t21-/m1/s1 |
| InChIKey | JAYZPFZBNBLMRV-OAQYLSRUSA-N |
| XLogP | 3.77 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |