C18H22N2O2S — CID 56865026
3-(3-phenylpropyl)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid (PubChem CID 56865026) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-(3-phenylpropyl)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid.
| Compound Name | 3-(3-phenylpropyl)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 56865026 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-(3-phenylpropyl)-1-(1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1(CCCc2ccccc2)CCCN(c2nccs2)C1 |
| InChI | InChI=1S/C18H22N2O2S/c21-16(22)18(9-4-8-15-6-2-1-3-7-15)10-5-12-20(14-18)17-19-11-13-23-17/h1-3,6-7,11,13H,4-5,8-10,12,14H2,(H,21,22) |
| InChIKey | MCFKMCQWXWWXIK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |