C23H38N4O — CID 95455862
(3R)-1-[1-(4-methylpentyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 95455862) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is (3R)-1-[1-(4-methylpentyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(4-methylpentyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95455862 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (3R)-1-[1-(4-methylpentyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | CC(C)CCCN1CCC(N2CCC[C@@H](C(=O)NCc3cccnc3)C2)CC1 |
| InChI | InChI=1S/C23H38N4O/c1-19(2)6-4-12-26-14-9-22(10-15-26)27-13-5-8-21(18-27)23(28)25-17-20-7-3-11-24-16-20/h3,7,11,16,19,21-22H,4-6,8-10,12-15,17-18H2,1-2H3,(H,25,28)/t21-/m1/s1 |
| InChIKey | OKTKEMDTUKOIED-OAQYLSRUSA-N |
| XLogP | 3.31 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |