C20H31FN4O — CID 95539325
(3R)-1-[1-(3-fluoropropyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 95539325) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is (3R)-1-[1-(3-fluoropropyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(3-fluoropropyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95539325 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (3R)-1-[1-(3-fluoropropyl)piperidin-4-yl]-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CCCN(C2CCN(CCCF)CC2)C1 |
| InChI | InChI=1S/C20H31FN4O/c21-8-3-10-24-12-6-19(7-13-24)25-11-2-5-18(16-25)20(26)23-15-17-4-1-9-22-14-17/h1,4,9,14,18-19H,2-3,5-8,10-13,15-16H2,(H,23,26)/t18-/m1/s1 |
| InChIKey | PICAIPIWUVUNRE-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |